C24H28N2O2 — CID 112805006
1-benzoyl-N-(1-phenylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 112805006) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-benzoyl-N-(1-phenylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | 1-benzoyl-N-(1-phenylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 112805006 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-benzoyl-N-(1-phenylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | CC(NC(=O)C1CC2CCCCC2N1C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O2/c1-17(18-10-4-2-5-11-18)25-23(27)22-16-20-14-8-9-15-21(20)26(22)24(28)19-12-6-3-7-13-19/h2-7,10-13,17,20-22H,8-9,14-16H2,1H3,(H,25,27) |
| InChIKey | HWUNFXICFUHUPU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |