C23H33N3O2 — CID 119544723
(1-benzoyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl)-[4-(methylaminomethyl)piperidin-1-yl]methanone (PubChem CID 119544723) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (1-benzoyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl)-[4-(methylaminomethyl)piperidin-1-yl]methanone.
| Compound Name | (1-benzoyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl)-[4-(methylaminomethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119544723 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (1-benzoyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl)-[4-(methylaminomethyl)piperidin-1-yl]methanone |
| SMILES | CNCC1CCN(C(=O)C2CC3CCCCC3N2C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H33N3O2/c1-24-16-17-11-13-25(14-12-17)23(28)21-15-19-9-5-6-10-20(19)26(21)22(27)18-7-3-2-4-8-18/h2-4,7-8,17,19-21,24H,5-6,9-16H2,1H3 |
| InChIKey | GBSBJCIMJBIXLW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |