C21H30ClN3O2 — CID 119485168
[3-(aminomethyl)pyrrolidin-1-yl]-(1-benzoyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl)methanone;hydrochloride (PubChem CID 119485168) has the molecular formula C21H30ClN3O2 and a molecular weight of 391.94 g/mol. Its IUPAC name is [3-(aminomethyl)pyrrolidin-1-yl]-(1-benzoyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl)methanone;hydrochloride.
| Compound Name | [3-(aminomethyl)pyrrolidin-1-yl]-(1-benzoyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119485168 |
| Molecular Formula | C21H30ClN3O2 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | [3-(aminomethyl)pyrrolidin-1-yl]-(1-benzoyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl)methanone;hydrochloride |
| SMILES | Cl.NCC1CCN(C(=O)C2CC3CCCCC3N2C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H29N3O2.ClH/c22-13-15-10-11-23(14-15)21(26)19-12-17-8-4-5-9-18(17)24(19)20(25)16-6-2-1-3-7-16;/h1-3,6-7,15,17-19H,4-5,8-14,22H2;1H |
| InChIKey | NLPSHQSXSQVFEN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |