About 3-phenoxycyclohexan-1-ol
3-phenoxycyclohexan-1-ol (PubChem CID 79617811) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-phenoxycyclohexan-1-ol.
Molecular Properties
| Compound Name | 3-phenoxycyclohexan-1-ol |
| PubChem CID | 79617811 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 3-phenoxycyclohexan-1-ol |
| SMILES | OC1CCCC(Oc2ccccc2)C1 |
| InChI | InChI=1S/C12H16O2/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-3,6-7,10,12-13H,4-5,8-9H2 |
| InChIKey | TWHZCHQLTJEXDU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenoxycyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenoxycyclohexan-1-ol?
The IUPAC name of 3-phenoxycyclohexan-1-ol (CID 79617811) is 3-phenoxycyclohexan-1-ol.
What is the SMILES notation for 3-phenoxycyclohexan-1-ol?
The canonical SMILES for 3-phenoxycyclohexan-1-ol is OC1CCCC(Oc2ccccc2)C1.
What is the InChIKey of 3-phenoxycyclohexan-1-ol?
The InChIKey is TWHZCHQLTJEXDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-3,6-7,10,12-13H,4-5,8-9H2.
What are the key properties of 3-phenoxycyclohexan-1-ol?
3-phenoxycyclohexan-1-ol has a molecular weight of 192.26 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenoxycyclohexan-1-ol is sourced from PubChem (CID 79617811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).