C13H15NO2 — CID 117052718
3-(3-hydroxycyclohexyl)oxybenzonitrile (PubChem CID 117052718) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-(3-hydroxycyclohexyl)oxybenzonitrile.
| Compound Name | 3-(3-hydroxycyclohexyl)oxybenzonitrile |
|---|---|
| PubChem CID | 117052718 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 3-(3-hydroxycyclohexyl)oxybenzonitrile |
| SMILES | N#Cc1cccc(OC2CCCC(O)C2)c1 |
| InChI | InChI=1S/C13H15NO2/c14-9-10-3-1-5-12(7-10)16-13-6-2-4-11(15)8-13/h1,3,5,7,11,13,15H,2,4,6,8H2 |
| InChIKey | MUNDHCGILAKEPB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |