C13H12N2O — CID 43292493
3-(2-cyanocyclopentyl)oxybenzonitrile (PubChem CID 43292493) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-(2-cyanocyclopentyl)oxybenzonitrile.
| Compound Name | 3-(2-cyanocyclopentyl)oxybenzonitrile |
|---|---|
| PubChem CID | 43292493 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 3-(2-cyanocyclopentyl)oxybenzonitrile |
| SMILES | N#Cc1cccc(OC2CCCC2C#N)c1 |
| InChI | InChI=1S/C13H12N2O/c14-8-10-3-1-5-12(7-10)16-13-6-2-4-11(13)9-15/h1,3,5,7,11,13H,2,4,6H2 |
| InChIKey | SLMNCJBNLYZIBU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |