C12H13FN2O — CID 129278036
3-[(3R,4R)-3-fluoropiperidin-4-yl]oxybenzonitrile (PubChem CID 129278036) has the molecular formula C12H13FN2O and a molecular weight of 220.25 g/mol. Its IUPAC name is 3-[(3R,4R)-3-fluoropiperidin-4-yl]oxybenzonitrile.
| Compound Name | 3-[(3R,4R)-3-fluoropiperidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 129278036 |
| Molecular Formula | C12H13FN2O |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3-[(3R,4R)-3-fluoropiperidin-4-yl]oxybenzonitrile |
| SMILES | N#Cc1cccc(O[C@@H]2CCNC[C@H]2F)c1 |
| InChI | InChI=1S/C12H13FN2O/c13-11-8-15-5-4-12(11)16-10-3-1-2-9(6-10)7-14/h1-3,6,11-12,15H,4-5,8H2/t11-,12-/m1/s1 |
| InChIKey | VDFKKMKFIMGLIJ-VXGBXAGGSA-N |
| XLogP | 1.64 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |