C19H29N3O2 — CID 69045352
1-methylpiperidin-3-ol;3-(1-methylpiperidin-3-yl)oxybenzonitrile (PubChem CID 69045352) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-methylpiperidin-3-ol;3-(1-methylpiperidin-3-yl)oxybenzonitrile.
| Compound Name | 1-methylpiperidin-3-ol;3-(1-methylpiperidin-3-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 69045352 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-methylpiperidin-3-ol;3-(1-methylpiperidin-3-yl)oxybenzonitrile |
| SMILES | CN1CCCC(O)C1.CN1CCCC(Oc2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C13H16N2O.C6H13NO/c1-15-7-3-6-13(10-15)16-12-5-2-4-11(8-12)9-14;1-7-4-2-3-6(8)5-7/h2,4-5,8,13H,3,6-7,10H2,1H3;6,8H,2-5H2,1H3 |
| InChIKey | WZJSHLCDFDDIGG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |