C20H32N2O — CID 145102187
acetylene;3-(1-butylazetidin-3-yl)oxybenzonitrile;ethane (PubChem CID 145102187) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is acetylene;3-(1-butylazetidin-3-yl)oxybenzonitrile;ethane.
| Compound Name | acetylene;3-(1-butylazetidin-3-yl)oxybenzonitrile;ethane |
|---|---|
| PubChem CID | 145102187 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | acetylene;3-(1-butylazetidin-3-yl)oxybenzonitrile;ethane |
| SMILES | C#C.CC.CC.CCCCN1CC(Oc2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C14H18N2O.2C2H6.C2H2/c1-2-3-7-16-10-14(11-16)17-13-6-4-5-12(8-13)9-15;3*1-2/h4-6,8,14H,2-3,7,10-11H2,1H3;2*1-2H3;1-2H |
| InChIKey | NZHYVOAGRHKKQU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|