C15H20OSi — CID 10332087
trans-(1R,2R)-2-[2-[dimethyl(phenyl)silyl]ethynyl]cyclopentan-1-ol (PubChem CID 10332087) has the molecular formula C15H20OSi and a molecular weight of 244.41 g/mol. Its IUPAC name is trans-(1R,2R)-2-[2-[dimethyl(phenyl)silyl]ethynyl]cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-[2-[dimethyl(phenyl)silyl]ethynyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 10332087 |
| Molecular Formula | C15H20OSi |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | trans-(1R,2R)-2-[2-[dimethyl(phenyl)silyl]ethynyl]cyclopentan-1-ol |
| SMILES | C[Si](C)(C#C[C@H]1CCC[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C15H20OSi/c1-17(2,14-8-4-3-5-9-14)12-11-13-7-6-10-15(13)16/h3-5,8-9,13,15-16H,6-7,10H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | OJDOWSFZMBULEG-UKRRQHHQSA-N |
| XLogP | 2.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|