C15H15NO2 — CID 11042883
(2R,3S,4R)-3-amino-2-phenyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 11042883) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is (2R,3S,4R)-3-amino-2-phenyl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (2R,3S,4R)-3-amino-2-phenyl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 11042883 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (2R,3S,4R)-3-amino-2-phenyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | N[C@H]1[C@H](O)c2ccccc2O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H15NO2/c16-13-14(17)11-8-4-5-9-12(11)18-15(13)10-6-2-1-3-7-10/h1-9,13-15,17H,16H2/t13-,14+,15+/m0/s1 |
| InChIKey | SSMXGNMVPYQPOE-RRFJBIMHSA-N |
| XLogP | 2.18 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |