C15H11NaO4 — CID 23688231
sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 23688231) has the molecular formula C15H11NaO4 and a molecular weight of 278.24 g/mol. Its IUPAC name is sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 23688231 |
| Molecular Formula | C15H11NaO4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | O=C([O-])C1Oc2ccccc2OC1c1ccccc1.[Na+] |
| InChI | InChI=1S/C15H12O4.Na/c16-15(17)14-13(10-6-2-1-3-7-10)18-11-8-4-5-9-12(11)19-14;/h1-9,13-14H,(H,16,17);/q;+1/p-1 |
| InChIKey | IVBFKWFJEBZZEJ-UHFFFAOYSA-M |
| XLogP | -1.68 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |