sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate

C15H11NaO4 — CID 23688231

IUPACsodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate
SMILESO=C([O-])C1Oc2ccccc2OC1c1ccccc1.[Na+]
InChIInChI=1S/C15H12O4.Na/c16-15(17)14-13(10-6-2-1-3-7-10)18-11-8-4-5-9-12(11)19-14;/h1-9,13-14H,(H,16,17);/q;+1/p-1
InChIKeyIVBFKWFJEBZZEJ-UHFFFAOYSA-M
MW278.24 g/mol
LogP-1.68
Rot. Bonds2

About sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate

sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 23688231) has the molecular formula C15H11NaO4 and a molecular weight of 278.24 g/mol. Its IUPAC name is sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate.

Molecular Properties

Compound Namesodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate
PubChem CID23688231
Molecular FormulaC15H11NaO4
Molecular Weight278.24 g/mol
Exact Mass278.06
IUPAC Namesodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate
SMILESO=C([O-])C1Oc2ccccc2OC1c1ccccc1.[Na+]
InChIInChI=1S/C15H12O4.Na/c16-15(17)14-13(10-6-2-1-3-7-10)18-11-8-4-5-9-12(11)19-14;/h1-9,13-14H,(H,16,17);/q;+1/p-1
InChIKeyIVBFKWFJEBZZEJ-UHFFFAOYSA-M
XLogP-1.68
TPSA58.59 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.24
LogP ≤ 5-1.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate?
The IUPAC name of sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate (CID 23688231) is sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate.
What is the SMILES notation for sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate?
The canonical SMILES for sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate is O=C([O-])C1Oc2ccccc2OC1c1ccccc1.[Na+].
What is the InChIKey of sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate?
The InChIKey is IVBFKWFJEBZZEJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H12O4.Na/c16-15(17)14-13(10-6-2-1-3-7-10)18-11-8-4-5-9-12(11)19-14;/h1-9,13-14H,(H,16,17);/q;+1/p-1.
What are the key properties of sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate?
sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate has a molecular weight of 278.24 g/mol, XLogP of -1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-phenyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate is sourced from PubChem (CID 23688231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).