C10H9O4- — CID 78428488
2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 78428488) has the molecular formula C10H9O4- and a molecular weight of 193.18 g/mol. Its IUPAC name is 2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | 2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 78428488 |
| Molecular Formula | C10H9O4- |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | CC1Oc2ccccc2OC1C(=O)[O-] |
| InChI | InChI=1S/C10H10O4/c1-6-9(10(11)12)14-8-5-3-2-4-7(8)13-6/h2-6,9H,1H3,(H,11,12)/p-1 |
| InChIKey | PBEHOGACXXHTFO-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |