C23H20O6 — CID 22687460
2-[4-(2-phenoxyethoxy)phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (PubChem CID 22687460) has the molecular formula C23H20O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-[4-(2-phenoxyethoxy)phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid.
| Compound Name | 2-[4-(2-phenoxyethoxy)phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
|---|---|
| PubChem CID | 22687460 |
| Molecular Formula | C23H20O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-[4-(2-phenoxyethoxy)phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
| SMILES | O=C(O)C1Oc2ccccc2OC1c1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C23H20O6/c24-23(25)22-21(28-19-8-4-5-9-20(19)29-22)16-10-12-18(13-11-16)27-15-14-26-17-6-2-1-3-7-17/h1-13,21-22H,14-15H2,(H,24,25) |
| InChIKey | TUOJOMYTQFXEBQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|