C21H24O6 — CID 22682562
2-(4-methoxy-3-pentoxyphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (PubChem CID 22682562) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-(4-methoxy-3-pentoxyphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid.
| Compound Name | 2-(4-methoxy-3-pentoxyphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
|---|---|
| PubChem CID | 22682562 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-(4-methoxy-3-pentoxyphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
| SMILES | CCCCCOc1cc(C2Oc3ccccc3OC2C(=O)O)ccc1OC |
| InChI | InChI=1S/C21H24O6/c1-3-4-7-12-25-18-13-14(10-11-15(18)24-2)19-20(21(22)23)27-17-9-6-5-8-16(17)26-19/h5-6,8-11,13,19-20H,3-4,7,12H2,1-2H3,(H,22,23) |
| InChIKey | KPAATMZEFDOGGR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|