C20H22O6 — CID 20994313
2-(3-butoxy-4-methoxyphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (PubChem CID 20994313) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-(3-butoxy-4-methoxyphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid.
| Compound Name | 2-(3-butoxy-4-methoxyphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
|---|---|
| PubChem CID | 20994313 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-(3-butoxy-4-methoxyphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
| SMILES | CCCCOc1cc(C2Oc3ccccc3OC2C(=O)O)ccc1OC |
| InChI | InChI=1S/C20H22O6/c1-3-4-11-24-17-12-13(9-10-14(17)23-2)18-19(20(21)22)26-16-8-6-5-7-15(16)25-18/h5-10,12,18-19H,3-4,11H2,1-2H3,(H,21,22) |
| InChIKey | ULBQPTMOPXWTNP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|