About (2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate
(2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate (PubChem CID 6941700) has the molecular formula C10H11NO2S
and a molecular weight of 209.27 g/mol. Its IUPAC name is (2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate.
Molecular Properties
| Compound Name | (2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate |
| PubChem CID | 6941700 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | (2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate |
| SMILES | O=C([O-])[C@H]1C[NH2+][C@@H](c2ccccc2)S1 |
| InChI | InChI=1S/C10H11NO2S/c12-10(13)8-6-11-9(14-8)7-4-2-1-3-5-7/h1-5,8-9,11H,6H2,(H,12,13)/t8-,9-/m1/s1 |
| InChIKey | QMLCPYVRJKOHQA-RKDXNWHRSA-N |
| XLogP | -0.89 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate?
The IUPAC name of (2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate (CID 6941700) is (2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate.
What is the SMILES notation for (2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate?
The canonical SMILES for (2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate is O=C([O-])[C@H]1C[NH2+][C@@H](c2ccccc2)S1.
What is the InChIKey of (2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate?
The InChIKey is QMLCPYVRJKOHQA-RKDXNWHRSA-N. The full InChI is InChI=1S/C10H11NO2S/c12-10(13)8-6-11-9(14-8)7-4-2-1-3-5-7/h1-5,8-9,11H,6H2,(H,12,13)/t8-,9-/m1/s1.
What are the key properties of (2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate?
(2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate has a molecular weight of 209.27 g/mol, XLogP of -0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-2-phenyl-1,3-thiazolidin-3-ium-5-carboxylate is sourced from PubChem (CID 6941700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).