C15H19N3O2 — CID 82346417
2-(oxolan-2-yl)-4-piperazin-1-yl-1,3-benzoxazole (PubChem CID 82346417) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-(oxolan-2-yl)-4-piperazin-1-yl-1,3-benzoxazole.
| Compound Name | 2-(oxolan-2-yl)-4-piperazin-1-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 82346417 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-(oxolan-2-yl)-4-piperazin-1-yl-1,3-benzoxazole |
| SMILES | c1cc(N2CCNCC2)c2nc(C3CCCO3)oc2c1 |
| InChI | InChI=1S/C15H19N3O2/c1-3-11(18-8-6-16-7-9-18)14-12(4-1)20-15(17-14)13-5-2-10-19-13/h1,3-4,13,16H,2,5-10H2 |
| InChIKey | RTVYFPVCZCDGPJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |