C16H21NO2 — CID 54362320
4-(3-methylbutyl)-2-(oxolan-2-yl)-1,3-benzoxazole (PubChem CID 54362320) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-(3-methylbutyl)-2-(oxolan-2-yl)-1,3-benzoxazole.
| Compound Name | 4-(3-methylbutyl)-2-(oxolan-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 54362320 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 4-(3-methylbutyl)-2-(oxolan-2-yl)-1,3-benzoxazole |
| SMILES | CC(C)CCc1cccc2oc(C3CCCO3)nc12 |
| InChI | InChI=1S/C16H21NO2/c1-11(2)8-9-12-5-3-6-13-15(12)17-16(19-13)14-7-4-10-18-14/h3,5-6,11,14H,4,7-10H2,1-2H3 |
| InChIKey | GGROSPWXYCLAMZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |