C21H22ClN3O3 — CID 141376481
3-(4-methyl-1,3-benzoxazol-2-yl)-7-piperazin-1-yl-3,4-dihydrochromen-2-one;hydrochloride (PubChem CID 141376481) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is 3-(4-methyl-1,3-benzoxazol-2-yl)-7-piperazin-1-yl-3,4-dihydrochromen-2-one;hydrochloride.
| Compound Name | 3-(4-methyl-1,3-benzoxazol-2-yl)-7-piperazin-1-yl-3,4-dihydrochromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 141376481 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-(4-methyl-1,3-benzoxazol-2-yl)-7-piperazin-1-yl-3,4-dihydrochromen-2-one;hydrochloride |
| SMILES | Cc1cccc2oc(C3Cc4ccc(N5CCNCC5)cc4OC3=O)nc12.Cl |
| InChI | InChI=1S/C21H21N3O3.ClH/c1-13-3-2-4-17-19(13)23-20(26-17)16-11-14-5-6-15(12-18(14)27-21(16)25)24-9-7-22-8-10-24;/h2-6,12,16,22H,7-11H2,1H3;1H |
| InChIKey | GIGSHZMIOVVGGF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|