C20H23N3O3 — CID 141376420
3-(6-methoxy-2-pyridinyl)-7-[(3S)-3-methylpiperazin-1-yl]-3,4-dihydrochromen-2-one (PubChem CID 141376420) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-(6-methoxy-2-pyridinyl)-7-[(3S)-3-methylpiperazin-1-yl]-3,4-dihydrochromen-2-one.
| Compound Name | 3-(6-methoxy-2-pyridinyl)-7-[(3S)-3-methylpiperazin-1-yl]-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 141376420 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-(6-methoxy-2-pyridinyl)-7-[(3S)-3-methylpiperazin-1-yl]-3,4-dihydrochromen-2-one |
| SMILES | COc1cccc(C2Cc3ccc(N4CCN[C@@H](C)C4)cc3OC2=O)n1 |
| InChI | InChI=1S/C20H23N3O3/c1-13-12-23(9-8-21-13)15-7-6-14-10-16(20(24)26-18(14)11-15)17-4-3-5-19(22-17)25-2/h3-7,11,13,16,21H,8-10,12H2,1-2H3/t13-,16?/m0/s1 |
| InChIKey | VDTWSQOAAPYOKO-KNVGNIICSA-N |
| XLogP | 2.13 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|