C17H20N4O2 — CID 141376524
3-(4-methyl-1H-pyrazol-5-yl)-7-piperazin-1-yl-3,4-dihydrochromen-2-one (PubChem CID 141376524) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-(4-methyl-1H-pyrazol-5-yl)-7-piperazin-1-yl-3,4-dihydrochromen-2-one.
| Compound Name | 3-(4-methyl-1H-pyrazol-5-yl)-7-piperazin-1-yl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 141376524 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-(4-methyl-1H-pyrazol-5-yl)-7-piperazin-1-yl-3,4-dihydrochromen-2-one |
| SMILES | Cc1cn[nH]c1C1Cc2ccc(N3CCNCC3)cc2OC1=O |
| InChI | InChI=1S/C17H20N4O2/c1-11-10-19-20-16(11)14-8-12-2-3-13(9-15(12)23-17(14)22)21-6-4-18-5-7-21/h2-3,9-10,14,18H,4-8H2,1H3,(H,19,20) |
| InChIKey | RDAICUPSRGJJKC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|