C18H22N4O2 — CID 141376412
7-(4-methylpiperazin-1-yl)-3-(1-methylpyrazol-3-yl)-3,4-dihydrochromen-2-one (PubChem CID 141376412) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrazol-3-yl)-3,4-dihydrochromen-2-one.
| Compound Name | 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrazol-3-yl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 141376412 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 7-(4-methylpiperazin-1-yl)-3-(1-methylpyrazol-3-yl)-3,4-dihydrochromen-2-one |
| SMILES | CN1CCN(c2ccc3c(c2)OC(=O)C(c2ccn(C)n2)C3)CC1 |
| InChI | InChI=1S/C18H22N4O2/c1-20-7-9-22(10-8-20)14-4-3-13-11-15(16-5-6-21(2)19-16)18(23)24-17(13)12-14/h3-6,12,15H,7-11H2,1-2H3 |
| InChIKey | OVKVEANDXBQDLX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|