C23H25N3O3 — CID 141376384
3-(4,6-dimethylfuro[3,2-c]pyridin-2-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one (PubChem CID 141376384) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-(4,6-dimethylfuro[3,2-c]pyridin-2-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one.
| Compound Name | 3-(4,6-dimethylfuro[3,2-c]pyridin-2-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 141376384 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 3-(4,6-dimethylfuro[3,2-c]pyridin-2-yl)-7-(4-methylpiperazin-1-yl)-3,4-dihydrochromen-2-one |
| SMILES | Cc1cc2oc(C3Cc4ccc(N5CCN(C)CC5)cc4OC3=O)cc2c(C)n1 |
| InChI | InChI=1S/C23H25N3O3/c1-14-10-21-18(15(2)24-14)13-22(28-21)19-11-16-4-5-17(12-20(16)29-23(19)27)26-8-6-25(3)7-9-26/h4-5,10,12-13,19H,6-9,11H2,1-3H3 |
| InChIKey | VPUAKGQAPPEGER-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|