C22H23N3O2S — CID 141376630
3-(2-methyl-1,3-benzothiazol-6-yl)-7-[(3S)-3-methylpiperazin-1-yl]-3,4-dihydrochromen-2-one (PubChem CID 141376630) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is 3-(2-methyl-1,3-benzothiazol-6-yl)-7-[(3S)-3-methylpiperazin-1-yl]-3,4-dihydrochromen-2-one.
| Compound Name | 3-(2-methyl-1,3-benzothiazol-6-yl)-7-[(3S)-3-methylpiperazin-1-yl]-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 141376630 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 3-(2-methyl-1,3-benzothiazol-6-yl)-7-[(3S)-3-methylpiperazin-1-yl]-3,4-dihydrochromen-2-one |
| SMILES | Cc1nc2ccc(C3Cc4ccc(N5CCN[C@@H](C)C5)cc4OC3=O)cc2s1 |
| InChI | InChI=1S/C22H23N3O2S/c1-13-12-25(8-7-23-13)17-5-3-16-9-18(22(26)27-20(16)11-17)15-4-6-19-21(10-15)28-14(2)24-19/h3-6,10-11,13,18,23H,7-9,12H2,1-2H3/t13-,18?/m0/s1 |
| InChIKey | BVYOPCWTANGIJP-FVRDMJKUSA-N |
| XLogP | 3.65 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|