C18H19N3O2S — CID 123296157
7-(3-methylpiperazin-1-yl)-3-(4-methyl-1,3-thiazol-2-yl)chromen-2-one (PubChem CID 123296157) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 7-(3-methylpiperazin-1-yl)-3-(4-methyl-1,3-thiazol-2-yl)chromen-2-one.
| Compound Name | 7-(3-methylpiperazin-1-yl)-3-(4-methyl-1,3-thiazol-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 123296157 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 7-(3-methylpiperazin-1-yl)-3-(4-methyl-1,3-thiazol-2-yl)chromen-2-one |
| SMILES | Cc1csc(-c2cc3ccc(N4CCNC(C)C4)cc3oc2=O)n1 |
| InChI | InChI=1S/C18H19N3O2S/c1-11-9-21(6-5-19-11)14-4-3-13-7-15(17-20-12(2)10-24-17)18(22)23-16(13)8-14/h3-4,7-8,10-11,19H,5-6,9H2,1-2H3 |
| InChIKey | FUEDMEPMIYMTAX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|