C22H22N4O2 — CID 123210784
3-(7-methylimidazo[1,2-a]pyridin-2-yl)-7-(3-methylpiperazin-1-yl)chromen-2-one (PubChem CID 123210784) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-(7-methylimidazo[1,2-a]pyridin-2-yl)-7-(3-methylpiperazin-1-yl)chromen-2-one.
| Compound Name | 3-(7-methylimidazo[1,2-a]pyridin-2-yl)-7-(3-methylpiperazin-1-yl)chromen-2-one |
|---|---|
| PubChem CID | 123210784 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3-(7-methylimidazo[1,2-a]pyridin-2-yl)-7-(3-methylpiperazin-1-yl)chromen-2-one |
| SMILES | Cc1ccn2cc(-c3cc4ccc(N5CCNC(C)C5)cc4oc3=O)nc2c1 |
| InChI | InChI=1S/C22H22N4O2/c1-14-5-7-26-13-19(24-21(26)9-14)18-10-16-3-4-17(11-20(16)28-22(18)27)25-8-6-23-15(2)12-25/h3-5,7,9-11,13,15,23H,6,8,12H2,1-2H3 |
| InChIKey | FGIQSNJZVMFREC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|