C21H19FN4O3 — CID 170703476
3-(7-fluoroimidazo[1,2-a]pyridin-2-yl)-7-[4-(hydroxymethyl)piperazin-1-yl]chromen-2-one (PubChem CID 170703476) has the molecular formula C21H19FN4O3 and a molecular weight of 394.41 g/mol. Its IUPAC name is 3-(7-fluoroimidazo[1,2-a]pyridin-2-yl)-7-[4-(hydroxymethyl)piperazin-1-yl]chromen-2-one.
| Compound Name | 3-(7-fluoroimidazo[1,2-a]pyridin-2-yl)-7-[4-(hydroxymethyl)piperazin-1-yl]chromen-2-one |
|---|---|
| PubChem CID | 170703476 |
| Molecular Formula | C21H19FN4O3 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 3-(7-fluoroimidazo[1,2-a]pyridin-2-yl)-7-[4-(hydroxymethyl)piperazin-1-yl]chromen-2-one |
| SMILES | O=c1oc2cc(N3CCN(CO)CC3)ccc2cc1-c1cn2ccc(F)cc2n1 |
| InChI | InChI=1S/C21H19FN4O3/c22-15-3-4-26-12-18(23-20(26)10-15)17-9-14-1-2-16(11-19(14)29-21(17)28)25-7-5-24(13-27)6-8-25/h1-4,9-12,27H,5-8,13H2 |
| InChIKey | OKCOLRGDJUKIFT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|