C22H21FN4O2 — CID 123206233
7-(3,5-dimethylpiperazin-1-yl)-3-(8-fluoroimidazo[1,2-a]pyridin-2-yl)chromen-2-one (PubChem CID 123206233) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is 7-(3,5-dimethylpiperazin-1-yl)-3-(8-fluoroimidazo[1,2-a]pyridin-2-yl)chromen-2-one.
| Compound Name | 7-(3,5-dimethylpiperazin-1-yl)-3-(8-fluoroimidazo[1,2-a]pyridin-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 123206233 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 7-(3,5-dimethylpiperazin-1-yl)-3-(8-fluoroimidazo[1,2-a]pyridin-2-yl)chromen-2-one |
| SMILES | CC1CN(c2ccc3cc(-c4cn5cccc(F)c5n4)c(=O)oc3c2)CC(C)N1 |
| InChI | InChI=1S/C22H21FN4O2/c1-13-10-27(11-14(2)24-13)16-6-5-15-8-17(22(28)29-20(15)9-16)19-12-26-7-3-4-18(23)21(26)25-19/h3-9,12-14,24H,10-11H2,1-2H3 |
| InChIKey | RVTNNMSAKXXYCB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|