C25H27FN4O2 — CID 123750179
7-(3,5-dimethylpiperazin-1-yl)-3-(3-fluoro-8-methyl-8,9-dihydropyrimido[1,2-a]azepin-7-yl)chromen-2-one (PubChem CID 123750179) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is 7-(3,5-dimethylpiperazin-1-yl)-3-(3-fluoro-8-methyl-8,9-dihydropyrimido[1,2-a]azepin-7-yl)chromen-2-one.
| Compound Name | 7-(3,5-dimethylpiperazin-1-yl)-3-(3-fluoro-8-methyl-8,9-dihydropyrimido[1,2-a]azepin-7-yl)chromen-2-one |
|---|---|
| PubChem CID | 123750179 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 7-(3,5-dimethylpiperazin-1-yl)-3-(3-fluoro-8-methyl-8,9-dihydropyrimido[1,2-a]azepin-7-yl)chromen-2-one |
| SMILES | CC1CN(c2ccc3cc(C4=CN5C=C(F)C=NC5=CCC4C)c(=O)oc3c2)CC(C)N1 |
| InChI | InChI=1S/C25H27FN4O2/c1-15-4-7-24-27-10-19(26)13-30(24)14-22(15)21-8-18-5-6-20(9-23(18)32-25(21)31)29-11-16(2)28-17(3)12-29/h5-10,13-17,28H,4,11-12H2,1-3H3 |
| InChIKey | RKHUFFZUNDREDU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|