C20H17N3O2 — CID 157263798
3-(1H-benzimidazol-2-yl)-7-(3-methylazetidin-1-yl)chromen-2-one (PubChem CID 157263798) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-7-(3-methylazetidin-1-yl)chromen-2-one.
| Compound Name | 3-(1H-benzimidazol-2-yl)-7-(3-methylazetidin-1-yl)chromen-2-one |
|---|---|
| PubChem CID | 157263798 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-7-(3-methylazetidin-1-yl)chromen-2-one |
| SMILES | CC1CN(c2ccc3cc(-c4nc5ccccc5[nH]4)c(=O)oc3c2)C1 |
| InChI | InChI=1S/C20H17N3O2/c1-12-10-23(11-12)14-7-6-13-8-15(20(24)25-18(13)9-14)19-21-16-4-2-3-5-17(16)22-19/h2-9,12H,10-11H2,1H3,(H,21,22) |
| InChIKey | KJVGYWFTYQUUHT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|