C22H19N3O2 — CID 88718489
3-(1H-benzimidazol-2-yl)-7-[bis(prop-2-enyl)amino]chromen-2-one (PubChem CID 88718489) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-7-[bis(prop-2-enyl)amino]chromen-2-one.
| Compound Name | 3-(1H-benzimidazol-2-yl)-7-[bis(prop-2-enyl)amino]chromen-2-one |
|---|---|
| PubChem CID | 88718489 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-7-[bis(prop-2-enyl)amino]chromen-2-one |
| SMILES | C=CCN(CC=C)c1ccc2cc(-c3nc4ccccc4[nH]3)c(=O)oc2c1 |
| InChI | InChI=1S/C22H19N3O2/c1-3-11-25(12-4-2)16-10-9-15-13-17(22(26)27-20(15)14-16)21-23-18-7-5-6-8-19(18)24-21/h3-10,13-14H,1-2,11-12H2,(H,23,24) |
| InChIKey | UWNBWLIQFAOINB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|