C27H31N3O2 — CID 123600118
3-(3,8-dimethyl-8,9-dihydropyrido[1,2-a]azepin-7-yl)-7-(4-ethylpiperazin-1-yl)chromen-2-one (PubChem CID 123600118) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 3-(3,8-dimethyl-8,9-dihydropyrido[1,2-a]azepin-7-yl)-7-(4-ethylpiperazin-1-yl)chromen-2-one.
| Compound Name | 3-(3,8-dimethyl-8,9-dihydropyrido[1,2-a]azepin-7-yl)-7-(4-ethylpiperazin-1-yl)chromen-2-one |
|---|---|
| PubChem CID | 123600118 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 3-(3,8-dimethyl-8,9-dihydropyrido[1,2-a]azepin-7-yl)-7-(4-ethylpiperazin-1-yl)chromen-2-one |
| SMILES | CCN1CCN(c2ccc3cc(C4=CN5C=C(C)C=CC5=CCC4C)c(=O)oc3c2)CC1 |
| InChI | InChI=1S/C27H31N3O2/c1-4-28-11-13-29(14-12-28)23-10-7-21-15-24(27(31)32-26(21)16-23)25-18-30-17-19(2)5-8-22(30)9-6-20(25)3/h5,7-10,15-18,20H,4,6,11-14H2,1-3H3 |
| InChIKey | MWIIJDAGYUXBNJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|