C20H20FN5O2 — CID 123623803
3-(6-fluoro-2,3-dihydroimidazo[1,2-a]pyrimidin-2-yl)-7-(4-methylpiperazin-1-yl)chromen-2-one (PubChem CID 123623803) has the molecular formula C20H20FN5O2 and a molecular weight of 381.41 g/mol. Its IUPAC name is 3-(6-fluoro-2,3-dihydroimidazo[1,2-a]pyrimidin-2-yl)-7-(4-methylpiperazin-1-yl)chromen-2-one.
| Compound Name | 3-(6-fluoro-2,3-dihydroimidazo[1,2-a]pyrimidin-2-yl)-7-(4-methylpiperazin-1-yl)chromen-2-one |
|---|---|
| PubChem CID | 123623803 |
| Molecular Formula | C20H20FN5O2 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 3-(6-fluoro-2,3-dihydroimidazo[1,2-a]pyrimidin-2-yl)-7-(4-methylpiperazin-1-yl)chromen-2-one |
| SMILES | CN1CCN(c2ccc3cc(C4CN5C=C(F)C=NC5=N4)c(=O)oc3c2)CC1 |
| InChI | InChI=1S/C20H20FN5O2/c1-24-4-6-25(7-5-24)15-3-2-13-8-16(19(27)28-18(13)9-15)17-12-26-11-14(21)10-22-20(26)23-17/h2-3,8-11,17H,4-7,12H2,1H3 |
| InChIKey | SYJMJGAZQOEVIN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|