C22H22N4O2 — CID 163611979
3-imidazo[1,2-a]pyridin-2-yl-7-(4-methyl-1,4-diazepan-1-yl)chromen-2-one (PubChem CID 163611979) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-2-yl-7-(4-methyl-1,4-diazepan-1-yl)chromen-2-one.
| Compound Name | 3-imidazo[1,2-a]pyridin-2-yl-7-(4-methyl-1,4-diazepan-1-yl)chromen-2-one |
|---|---|
| PubChem CID | 163611979 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-2-yl-7-(4-methyl-1,4-diazepan-1-yl)chromen-2-one |
| SMILES | CN1CCCN(c2ccc3cc(-c4cn5ccccc5n4)c(=O)oc3c2)CC1 |
| InChI | InChI=1S/C22H22N4O2/c1-24-8-4-10-25(12-11-24)17-7-6-16-13-18(22(27)28-20(16)14-17)19-15-26-9-3-2-5-21(26)23-19/h2-3,5-7,9,13-15H,4,8,10-12H2,1H3 |
| InChIKey | HGSBXLHIJIADBD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|