C22H20ClN3O2S — CID 78137032
3-(4-chloro-1,3-benzothiazol-2-yl)-7-(3,5-dimethylpiperazin-1-yl)chromen-2-one (PubChem CID 78137032) has the molecular formula C22H20ClN3O2S and a molecular weight of 425.94 g/mol. Its IUPAC name is 3-(4-chloro-1,3-benzothiazol-2-yl)-7-(3,5-dimethylpiperazin-1-yl)chromen-2-one.
| Compound Name | 3-(4-chloro-1,3-benzothiazol-2-yl)-7-(3,5-dimethylpiperazin-1-yl)chromen-2-one |
|---|---|
| PubChem CID | 78137032 |
| Molecular Formula | C22H20ClN3O2S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 3-(4-chloro-1,3-benzothiazol-2-yl)-7-(3,5-dimethylpiperazin-1-yl)chromen-2-one |
| SMILES | CC1CN(c2ccc3cc(-c4nc5c(Cl)cccc5s4)c(=O)oc3c2)CC(C)N1 |
| InChI | InChI=1S/C22H20ClN3O2S/c1-12-10-26(11-13(2)24-12)15-7-6-14-8-16(22(27)28-18(14)9-15)21-25-20-17(23)4-3-5-19(20)29-21/h3-9,12-13,24H,10-11H2,1-2H3 |
| InChIKey | NEHSOIGXWZCDTB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|