C26H29N5O2 — CID 123619870
3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)-7-(5-propan-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)chromen-2-one (PubChem CID 123619870) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)-7-(5-propan-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)chromen-2-one.
| Compound Name | 3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)-7-(5-propan-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 123619870 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)-7-(5-propan-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)chromen-2-one |
| SMILES | Cc1cn2cc(-c3cc4ccc(N5CC6CN(C(C)C)CC6C5)cc4oc3=O)nc2c(C)n1 |
| InChI | InChI=1S/C26H29N5O2/c1-15(2)29-10-19-12-30(13-20(19)11-29)21-6-5-18-7-22(26(32)33-24(18)8-21)23-14-31-9-16(3)27-17(4)25(31)28-23/h5-9,14-15,19-20H,10-13H2,1-4H3 |
| InChIKey | RGPITMDLOSBCTP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|