C22H23N5O2 — CID 123601059
7-[3-(aminomethyl)pyrrolidin-1-yl]-3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one (PubChem CID 123601059) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 7-[3-(aminomethyl)pyrrolidin-1-yl]-3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one.
| Compound Name | 7-[3-(aminomethyl)pyrrolidin-1-yl]-3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 123601059 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 7-[3-(aminomethyl)pyrrolidin-1-yl]-3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one |
| SMILES | Cc1cn2cc(-c3cc4ccc(N5CCC(CN)C5)cc4oc3=O)nc2c(C)n1 |
| InChI | InChI=1S/C22H23N5O2/c1-13-10-27-12-19(25-21(27)14(2)24-13)18-7-16-3-4-17(8-20(16)29-22(18)28)26-6-5-15(9-23)11-26/h3-4,7-8,10,12,15H,5-6,9,11,23H2,1-2H3 |
| InChIKey | WKOKBHAUYFFACL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|