C12H14F2N2O2 — CID 64926368
1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-methylpiperazine (PubChem CID 64926368) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-methylpiperazine.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-methylpiperazine |
|---|---|
| PubChem CID | 64926368 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-methylpiperazine |
| SMILES | CC1CN(c2ccc3c(c2)OC(F)(F)O3)CCN1 |
| InChI | InChI=1S/C12H14F2N2O2/c1-8-7-16(5-4-15-8)9-2-3-10-11(6-9)18-12(13,14)17-10/h2-3,6,8,15H,4-5,7H2,1H3 |
| InChIKey | YMAGUNKKIBYVAA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|