C14H18F2N2O2 — CID 64943674
1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-ethyl-1,4-diazepane (PubChem CID 64943674) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-ethyl-1,4-diazepane.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-ethyl-1,4-diazepane |
|---|---|
| PubChem CID | 64943674 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-ethyl-1,4-diazepane |
| SMILES | CCC1CN(c2ccc3c(c2)OC(F)(F)O3)CCCN1 |
| InChI | InChI=1S/C14H18F2N2O2/c1-2-10-9-18(7-3-6-17-10)11-4-5-12-13(8-11)20-14(15,16)19-12/h4-5,8,10,17H,2-3,6-7,9H2,1H3 |
| InChIKey | OLHSELTVIIFCNA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|