C13H18F2N2 — CID 64943922
1-(2,6-difluorophenyl)-3-ethyl-1,4-diazepane (PubChem CID 64943922) has the molecular formula C13H18F2N2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-ethyl-1,4-diazepane.
| Compound Name | 1-(2,6-difluorophenyl)-3-ethyl-1,4-diazepane |
|---|---|
| PubChem CID | 64943922 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-ethyl-1,4-diazepane |
| SMILES | CCC1CN(c2c(F)cccc2F)CCCN1 |
| InChI | InChI=1S/C13H18F2N2/c1-2-10-9-17(8-4-7-16-10)13-11(14)5-3-6-12(13)15/h3,5-6,10,16H,2,4,7-9H2,1H3 |
| InChIKey | UFZQQROMDGYNFR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |