About 4-ethyl-1-(4-fluorophenyl)-1,5-diazocane
4-ethyl-1-(4-fluorophenyl)-1,5-diazocane (PubChem CID 54973042) has the molecular formula C14H21FN2
and a molecular weight of 236.33 g/mol. Its IUPAC name is 4-ethyl-1-(4-fluorophenyl)-1,5-diazocane.
Molecular Properties
| Compound Name | 4-ethyl-1-(4-fluorophenyl)-1,5-diazocane |
| PubChem CID | 54973042 |
| Molecular Formula | C14H21FN2 |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 4-ethyl-1-(4-fluorophenyl)-1,5-diazocane |
| SMILES | CCC1CCN(c2ccc(F)cc2)CCCN1 |
| InChI | InChI=1S/C14H21FN2/c1-2-13-8-11-17(10-3-9-16-13)14-6-4-12(15)5-7-14/h4-7,13,16H,2-3,8-11H2,1H3 |
| InChIKey | WCSNEADGMCKEPB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-1-(4-fluorophenyl)-1,5-diazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-(4-fluorophenyl)-1,5-diazocane?
The IUPAC name of 4-ethyl-1-(4-fluorophenyl)-1,5-diazocane (CID 54973042) is 4-ethyl-1-(4-fluorophenyl)-1,5-diazocane.
What is the SMILES notation for 4-ethyl-1-(4-fluorophenyl)-1,5-diazocane?
The canonical SMILES for 4-ethyl-1-(4-fluorophenyl)-1,5-diazocane is CCC1CCN(c2ccc(F)cc2)CCCN1.
What is the InChIKey of 4-ethyl-1-(4-fluorophenyl)-1,5-diazocane?
The InChIKey is WCSNEADGMCKEPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21FN2/c1-2-13-8-11-17(10-3-9-16-13)14-6-4-12(15)5-7-14/h4-7,13,16H,2-3,8-11H2,1H3.
What are the key properties of 4-ethyl-1-(4-fluorophenyl)-1,5-diazocane?
4-ethyl-1-(4-fluorophenyl)-1,5-diazocane has a molecular weight of 236.33 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-(4-fluorophenyl)-1,5-diazocane is sourced from PubChem (CID 54973042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).