C12H11ClN2OS — CID 168688400
4-chloro-1-(2-methyl-1,3-benzothiazol-6-yl)pyrrolidin-2-one (PubChem CID 168688400) has the molecular formula C12H11ClN2OS and a molecular weight of 266.75 g/mol. Its IUPAC name is 4-chloro-1-(2-methyl-1,3-benzothiazol-6-yl)pyrrolidin-2-one.
| Compound Name | 4-chloro-1-(2-methyl-1,3-benzothiazol-6-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168688400 |
| Molecular Formula | C12H11ClN2OS |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 4-chloro-1-(2-methyl-1,3-benzothiazol-6-yl)pyrrolidin-2-one |
| SMILES | Cc1nc2ccc(N3CC(Cl)CC3=O)cc2s1 |
| InChI | InChI=1S/C12H11ClN2OS/c1-7-14-10-3-2-9(5-11(10)17-7)15-6-8(13)4-12(15)16/h2-3,5,8H,4,6H2,1H3 |
| InChIKey | QJBDHUBIPJZIRT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|