C10H8ClN3OS — CID 168689724
1-(2,1,3-benzothiadiazol-5-yl)-4-chloropyrrolidin-2-one (PubChem CID 168689724) has the molecular formula C10H8ClN3OS and a molecular weight of 253.71 g/mol. Its IUPAC name is 1-(2,1,3-benzothiadiazol-5-yl)-4-chloropyrrolidin-2-one.
| Compound Name | 1-(2,1,3-benzothiadiazol-5-yl)-4-chloropyrrolidin-2-one |
|---|---|
| PubChem CID | 168689724 |
| Molecular Formula | C10H8ClN3OS |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 1-(2,1,3-benzothiadiazol-5-yl)-4-chloropyrrolidin-2-one |
| SMILES | O=C1CC(Cl)CN1c1ccc2nsnc2c1 |
| InChI | InChI=1S/C10H8ClN3OS/c11-6-3-10(15)14(5-6)7-1-2-8-9(4-7)13-16-12-8/h1-2,4,6H,3,5H2 |
| InChIKey | ZPYUDJDWCODEIA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|