C10H11ClN2O4S — CID 168689165
2-amino-4-(4-chloro-2-oxopyrrolidin-1-yl)benzenesulfonic acid (PubChem CID 168689165) has the molecular formula C10H11ClN2O4S and a molecular weight of 290.73 g/mol. Its IUPAC name is 2-amino-4-(4-chloro-2-oxopyrrolidin-1-yl)benzenesulfonic acid.
| Compound Name | 2-amino-4-(4-chloro-2-oxopyrrolidin-1-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 168689165 |
| Molecular Formula | C10H11ClN2O4S |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 2-amino-4-(4-chloro-2-oxopyrrolidin-1-yl)benzenesulfonic acid |
| SMILES | Nc1cc(N2CC(Cl)CC2=O)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C10H11ClN2O4S/c11-6-3-10(14)13(5-6)7-1-2-9(8(12)4-7)18(15,16)17/h1-2,4,6H,3,5,12H2,(H,15,16,17) |
| InChIKey | GOSMCSZHCISEQY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|