C12H10ClNO5 — CID 168689651
5-(4-chloro-2-oxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid (PubChem CID 168689651) has the molecular formula C12H10ClNO5 and a molecular weight of 283.67 g/mol. Its IUPAC name is 5-(4-chloro-2-oxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(4-chloro-2-oxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 168689651 |
| Molecular Formula | C12H10ClNO5 |
| Molecular Weight | 283.67 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 5-(4-chloro-2-oxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(N2CC(Cl)CC2=O)c1 |
| InChI | InChI=1S/C12H10ClNO5/c13-8-4-10(15)14(5-8)9-2-6(11(16)17)1-7(3-9)12(18)19/h1-3,8H,4-5H2,(H,16,17)(H,18,19) |
| InChIKey | ZQFFSWVHQDCRRL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.67 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|