C11H11ClN2O3 — CID 168509330
5-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carboxylic acid (PubChem CID 168509330) has the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. Its IUPAC name is 5-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carboxylic acid.
| Compound Name | 5-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 168509330 |
| Molecular Formula | C11H11ClN2O3 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 5-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cncc(N2CC(CCl)CC2=O)c1 |
| InChI | InChI=1S/C11H11ClN2O3/c12-3-7-1-10(15)14(6-7)9-2-8(11(16)17)4-13-5-9/h2,4-5,7H,1,3,6H2,(H,16,17) |
| InChIKey | QPROTHUPXNCPAI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|