C11H10ClN3O5 — CID 168509177
6-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-nitropyridine-3-carboxylic acid (PubChem CID 168509177) has the molecular formula C11H10ClN3O5 and a molecular weight of 299.67 g/mol. Its IUPAC name is 6-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-nitropyridine-3-carboxylic acid.
| Compound Name | 6-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-nitropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 168509177 |
| Molecular Formula | C11H10ClN3O5 |
| Molecular Weight | 299.67 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 6-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-nitropyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(N2CC(CCl)CC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H10ClN3O5/c12-3-6-1-9(16)14(5-6)10-8(15(19)20)2-7(4-13-10)11(17)18/h2,4,6H,1,3,5H2,(H,17,18) |
| InChIKey | LOFRPVHDQKFBBL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.67 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|