C13H13N3O7 — CID 168693362
methyl 6-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)-5-nitropyridine-3-carboxylate (PubChem CID 168693362) has the molecular formula C13H13N3O7 and a molecular weight of 323.26 g/mol. Its IUPAC name is methyl 6-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)-5-nitropyridine-3-carboxylate.
| Compound Name | methyl 6-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)-5-nitropyridine-3-carboxylate |
|---|---|
| PubChem CID | 168693362 |
| Molecular Formula | C13H13N3O7 |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | methyl 6-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)-5-nitropyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(N2CC(C(=O)OC)CC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H13N3O7/c1-22-12(18)7-3-9(16(20)21)11(14-5-7)15-6-8(4-10(15)17)13(19)23-2/h3,5,8H,4,6H2,1-2H3 |
| InChIKey | HEUBTFZRPDHUJE-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 128.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|