C11H11N3O5 — CID 168694771
methyl 1-(5-nitro-2-pyridinyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 168694771) has the molecular formula C11H11N3O5 and a molecular weight of 265.23 g/mol. Its IUPAC name is methyl 1-(5-nitro-2-pyridinyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(5-nitro-2-pyridinyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168694771 |
| Molecular Formula | C11H11N3O5 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | methyl 1-(5-nitro-2-pyridinyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2ccc([N+](=O)[O-])cn2)C1 |
| InChI | InChI=1S/C11H11N3O5/c1-19-11(16)7-4-10(15)13(6-7)9-3-2-8(5-12-9)14(17)18/h2-3,5,7H,4,6H2,1H3 |
| InChIKey | YVIGDBQXSSLDJY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|